C20H24BrFN2O — CID 55378168
N-[(5-bromo-2-fluorophenyl)methyl]-2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethanamine (PubChem CID 55378168) has the molecular formula C20H24BrFN2O and a molecular weight of 407.33 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethanamine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 55378168 |
| Molecular Formula | C20H24BrFN2O |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethanamine |
| SMILES | COc1cccc(C(CNCc2cc(Br)ccc2F)N2CCCC2)c1 |
| InChI | InChI=1S/C20H24BrFN2O/c1-25-18-6-4-5-15(12-18)20(24-9-2-3-10-24)14-23-13-16-11-17(21)7-8-19(16)22/h4-8,11-12,20,23H,2-3,9-10,13-14H2,1H3 |
| InChIKey | BIVBFTYQNBLZFL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |