C20H24BrFN2O2 — CID 47008151
N-[(5-bromo-2-fluorophenyl)methyl]-2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine (PubChem CID 47008151) has the molecular formula C20H24BrFN2O2 and a molecular weight of 423.33 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 47008151 |
| Molecular Formula | C20H24BrFN2O2 |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine |
| SMILES | COc1ccc(C(CNCc2cc(Br)ccc2F)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H24BrFN2O2/c1-25-18-5-2-15(3-6-18)20(24-8-10-26-11-9-24)14-23-13-16-12-17(21)4-7-19(16)22/h2-7,12,20,23H,8-11,13-14H2,1H3 |
| InChIKey | JXPXGHKXGVCQEC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |