C21H26F3IN4O2 — CID 111030435
2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 111030435) has the molecular formula C21H26F3IN4O2 and a molecular weight of 550.36 g/mol. Its IUPAC name is 2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111030435 |
| Molecular Formula | C21H26F3IN4O2 |
| Molecular Weight | 550.36 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | 2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | COc1cccc(C(C/N=C(\N)Nc2ccc(OC(F)(F)F)cc2)N2CCCC2)c1.I |
| InChI | InChI=1S/C21H25F3N4O2.HI/c1-29-18-6-4-5-15(13-18)19(28-11-2-3-12-28)14-26-20(25)27-16-7-9-17(10-8-16)30-21(22,23)24;/h4-10,13,19H,2-3,11-12,14H2,1H3,(H3,25,26,27);1H |
| InChIKey | LDZSNXVOSWIMAS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|