C22H27N3O — CID 119137893
4-[[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]methyl]benzonitrile (PubChem CID 119137893) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-[[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]methyl]benzonitrile.
| Compound Name | 4-[[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 119137893 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 4-[[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]methyl]benzonitrile |
| SMILES | COc1ccc(C(CNCc2ccc(C#N)cc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H27N3O/c1-26-21-11-9-20(10-12-21)22(25-13-3-2-4-14-25)17-24-16-19-7-5-18(15-23)6-8-19/h5-12,22,24H,2-4,13-14,16-17H2,1H3 |
| InChIKey | OQUWXWNNWSZMAV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |