C23H28N2O3 — CID 55387516
N-[(7-methoxy-1-benzofuran-2-yl)methyl]-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethanamine (PubChem CID 55387516) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[(7-methoxy-1-benzofuran-2-yl)methyl]-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethanamine.
| Compound Name | N-[(7-methoxy-1-benzofuran-2-yl)methyl]-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 55387516 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[(7-methoxy-1-benzofuran-2-yl)methyl]-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethanamine |
| SMILES | COc1ccc(C(CNCc2cc3cccc(OC)c3o2)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-26-19-10-8-17(9-11-19)21(25-12-3-4-13-25)16-24-15-20-14-18-6-5-7-22(27-2)23(18)28-20/h5-11,14,21,24H,3-4,12-13,15-16H2,1-2H3 |
| InChIKey | ICEOIHZCANVUKH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |