C11H8F7N — CID 173495553
(E)-3-[3,5-bis(trifluoromethyl)phenyl]-1-fluoroprop-1-en-1-amine (PubChem CID 173495553) has the molecular formula C11H8F7N and a molecular weight of 287.18 g/mol. Its IUPAC name is (E)-3-[3,5-bis(trifluoromethyl)phenyl]-1-fluoroprop-1-en-1-amine.
| Compound Name | (E)-3-[3,5-bis(trifluoromethyl)phenyl]-1-fluoroprop-1-en-1-amine |
|---|---|
| PubChem CID | 173495553 |
| Molecular Formula | C11H8F7N |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (E)-3-[3,5-bis(trifluoromethyl)phenyl]-1-fluoroprop-1-en-1-amine |
| SMILES | N/C(F)=C\Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F7N/c12-9(19)2-1-6-3-7(10(13,14)15)5-8(4-6)11(16,17)18/h2-5H,1,19H2/b9-2- |
| InChIKey | DLHYZSSBSAEPRL-MBXJOHMKSA-N |
| XLogP | 4.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|