C24H40NO2+ — CID 124853506
(2R)-1-(1-benzylpyrrolidin-1-ium-1-yl)-3-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-2-ol (PubChem CID 124853506) has the molecular formula C24H40NO2+ and a molecular weight of 374.59 g/mol. Its IUPAC name is (2R)-1-(1-benzylpyrrolidin-1-ium-1-yl)-3-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-2-ol.
| Compound Name | (2R)-1-(1-benzylpyrrolidin-1-ium-1-yl)-3-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-2-ol |
|---|---|
| PubChem CID | 124853506 |
| Molecular Formula | C24H40NO2+ |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.31 |
| IUPAC Name | (2R)-1-(1-benzylpyrrolidin-1-ium-1-yl)-3-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-2-ol |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@@H]1OC[C@H](O)C[N+]1(Cc2ccccc2)CCCC1 |
| InChI | InChI=1S/C24H40NO2/c1-19(2)23-12-11-20(3)15-24(23)27-18-22(26)17-25(13-7-8-14-25)16-21-9-5-4-6-10-21/h4-6,9-10,19-20,22-24,26H,7-8,11-18H2,1-3H3/q+1/t20-,22-,23-,24+/m1/s1 |
| InChIKey | QLVGGLZNWFXOKW-BUZMGHMJSA-N |
| XLogP | 4.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|