C36H50N2O4+2 — CID 3064785
1-(1-benzylpiperidin-1-ium-1-yl)-3-[3-[3-(1-benzylpiperidin-1-ium-1-yl)-2-hydroxypropoxy]phenoxy]propan-2-ol (PubChem CID 3064785) has the molecular formula C36H50N2O4+2 and a molecular weight of 574.81 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-1-ium-1-yl)-3-[3-[3-(1-benzylpiperidin-1-ium-1-yl)-2-hydroxypropoxy]phenoxy]propan-2-ol.
| Compound Name | 1-(1-benzylpiperidin-1-ium-1-yl)-3-[3-[3-(1-benzylpiperidin-1-ium-1-yl)-2-hydroxypropoxy]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 3064785 |
| Molecular Formula | C36H50N2O4+2 |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.38 |
| IUPAC Name | 1-(1-benzylpiperidin-1-ium-1-yl)-3-[3-[3-(1-benzylpiperidin-1-ium-1-yl)-2-hydroxypropoxy]phenoxy]propan-2-ol |
| SMILES | OC(COc1cccc(OCC(O)C[N+]2(Cc3ccccc3)CCCCC2)c1)C[N+]1(Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C36H50N2O4/c39-33(27-37(20-9-3-10-21-37)25-31-14-5-1-6-15-31)29-41-35-18-13-19-36(24-35)42-30-34(40)28-38(22-11-4-12-23-38)26-32-16-7-2-8-17-32/h1-2,5-8,13-19,24,33-34,39-40H,3-4,9-12,20-23,25-30H2/q+2 |
| InChIKey | FHPZGHIEWULIHS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|