C20H26NS2+ — CID 124924050
(1R)-1-benzyl-1-cyclohexyl-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione (PubChem CID 124924050) has the molecular formula C20H26NS2+ and a molecular weight of 344.57 g/mol. Its IUPAC name is (1R)-1-benzyl-1-cyclohexyl-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione.
| Compound Name | (1R)-1-benzyl-1-cyclohexyl-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione |
|---|---|
| PubChem CID | 124924050 |
| Molecular Formula | C20H26NS2+ |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (1R)-1-benzyl-1-cyclohexyl-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione |
| SMILES | S=C1S[N@+](Cc2ccccc2)(C2CCCCC2)C2=C1CCCC2 |
| InChI | InChI=1S/C20H26NS2/c22-20-18-13-7-8-14-19(18)21(23-20,17-11-5-2-6-12-17)15-16-9-3-1-4-10-16/h1,3-4,9-10,17H,2,5-8,11-15H2/q+1/t21-/m1/s1 |
| InChIKey | ISAODXFETDBOHH-OAQYLSRUSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|