C20H26ClNS2 — CID 18527741
1-benzyl-1-cyclohexyl-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione chloride (PubChem CID 18527741) has the molecular formula C20H26ClNS2 and a molecular weight of 380.02 g/mol. Its IUPAC name is 1-benzyl-1-cyclohexyl-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione chloride.
| Compound Name | 1-benzyl-1-cyclohexyl-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione chloride |
|---|---|
| PubChem CID | 18527741 |
| Molecular Formula | C20H26ClNS2 |
| Molecular Weight | 380.02 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-benzyl-1-cyclohexyl-4,5,6,7-tetrahydro-2,1-benzothiazol-1-ium-3-thione chloride |
| SMILES | S=C1S[N+](Cc2ccccc2)(C2CCCCC2)C2=C1CCCC2.[Cl-] |
| InChI | InChI=1S/C20H26NS2.ClH/c22-20-18-13-7-8-14-19(18)21(23-20,17-11-5-2-6-12-17)15-16-9-3-1-4-10-16;/h1,3-4,9-10,17H,2,5-8,11-15H2;1H/q+1;/p-1 |
| InChIKey | LVFWVAHTPAQLSJ-UHFFFAOYSA-M |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.02 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|