C25H30N2O+2 — CID 58393197
[4-(1-benzyl-1-methylpiperidin-1-ium-3-yl)oxyphenyl]-phenylazanium (PubChem CID 58393197) has the molecular formula C25H30N2O+2 and a molecular weight of 374.53 g/mol. Its IUPAC name is [4-(1-benzyl-1-methylpiperidin-1-ium-3-yl)oxyphenyl]-phenylazanium.
| Compound Name | [4-(1-benzyl-1-methylpiperidin-1-ium-3-yl)oxyphenyl]-phenylazanium |
|---|---|
| PubChem CID | 58393197 |
| Molecular Formula | C25H30N2O+2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | [4-(1-benzyl-1-methylpiperidin-1-ium-3-yl)oxyphenyl]-phenylazanium |
| SMILES | C[N+]1(Cc2ccccc2)CCCC(Oc2ccc([NH2+]c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H29N2O/c1-27(19-21-9-4-2-5-10-21)18-8-13-25(20-27)28-24-16-14-23(15-17-24)26-22-11-6-3-7-12-22/h2-7,9-12,14-17,25-26H,8,13,18-20H2,1H3/q+1/p+1 |
| InChIKey | RNLPDXGGXKJXDU-UHFFFAOYSA-O |
| XLogP | 4.40 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|