C27H31N2O+ — CID 129278550
N-[(1R,3R)-1-benzyl-1-methylpiperidin-1-ium-3-yl]-2,2-diphenylacetamide (PubChem CID 129278550) has the molecular formula C27H31N2O+ and a molecular weight of 399.56 g/mol. Its IUPAC name is N-[(1R,3R)-1-benzyl-1-methylpiperidin-1-ium-3-yl]-2,2-diphenylacetamide.
| Compound Name | N-[(1R,3R)-1-benzyl-1-methylpiperidin-1-ium-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 129278550 |
| Molecular Formula | C27H31N2O+ |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | N-[(1R,3R)-1-benzyl-1-methylpiperidin-1-ium-3-yl]-2,2-diphenylacetamide |
| SMILES | C[N@+]1(Cc2ccccc2)CCC[C@@H](NC(=O)C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C27H30N2O/c1-29(20-22-12-5-2-6-13-22)19-11-18-25(21-29)28-27(30)26(23-14-7-3-8-15-23)24-16-9-4-10-17-24/h2-10,12-17,25-26H,11,18-21H2,1H3/p+1/t25-,29-/m1/s1 |
| InChIKey | DEYSRUSBHKOVJO-VAVYLYDRSA-O |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|