C16H22NO4+ — CID 87227474
(1S,3S)-1-benzyl-3,6-dimethylpiperidin-1-ium-1,3-dicarboxylic acid (PubChem CID 87227474) has the molecular formula C16H22NO4+ and a molecular weight of 292.35 g/mol. Its IUPAC name is (1S,3S)-1-benzyl-3,6-dimethylpiperidin-1-ium-1,3-dicarboxylic acid.
| Compound Name | (1S,3S)-1-benzyl-3,6-dimethylpiperidin-1-ium-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 87227474 |
| Molecular Formula | C16H22NO4+ |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (1S,3S)-1-benzyl-3,6-dimethylpiperidin-1-ium-1,3-dicarboxylic acid |
| SMILES | CC1CC[C@](C)(C(=O)O)C[N@+]1(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H21NO4/c1-12-8-9-16(2,14(18)19)11-17(12,15(20)21)10-13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3,(H-,18,19,20,21)/p+1/t12?,16-,17-/m0/s1 |
| InChIKey | KVFNALKNYKGYDE-XZNKJRRYSA-O |
| XLogP | 2.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|