C20H29N2O6+ — CID 87446479
(1S,3S)-1-benzyl-3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-ium-1,3-dicarboxylic acid (PubChem CID 87446479) has the molecular formula C20H29N2O6+ and a molecular weight of 393.46 g/mol. Its IUPAC name is (1S,3S)-1-benzyl-3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-ium-1,3-dicarboxylic acid.
| Compound Name | (1S,3S)-1-benzyl-3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-ium-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 87446479 |
| Molecular Formula | C20H29N2O6+ |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | (1S,3S)-1-benzyl-3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-ium-1,3-dicarboxylic acid |
| SMILES | CC(C)(C)OC(=O)NC1C[C@](C)(C(=O)O)C[N@+](Cc2ccccc2)(C(=O)O)C1 |
| InChI | InChI=1S/C20H28N2O6/c1-19(2,3)28-17(25)21-15-10-20(4,16(23)24)13-22(12-15,18(26)27)11-14-8-6-5-7-9-14/h5-9,15H,10-13H2,1-4H3,(H2-,21,23,24,25,26,27)/p+1/t15?,20-,22+/m0/s1 |
| InChIKey | XINRZSDYUSEUDW-DIUPPUJESA-O |
| XLogP | 3.07 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|