C23H35N3O4 — CID 87488650
(4R)-1-benzyl-4-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]azepan-1-ium-1-carboxylate (PubChem CID 87488650) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is (4R)-1-benzyl-4-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]azepan-1-ium-1-carboxylate.
| Compound Name | (4R)-1-benzyl-4-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]azepan-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87488650 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | (4R)-1-benzyl-4-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]azepan-1-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN([C@@H]2CCC[N+](Cc3ccccc3)(C(=O)[O-])CC2)C1 |
| InChI | InChI=1S/C23H35N3O4/c1-23(2,3)30-21(27)24-19-11-13-25(16-19)20-10-7-14-26(15-12-20,22(28)29)17-18-8-5-4-6-9-18/h4-6,8-9,19-20H,7,10-17H2,1-3H3,(H-,24,27,28,29)/t19-,20-,26?/m1/s1 |
| InChIKey | JWILSDNNTVLOOW-FUHTXCSMSA-N |
| XLogP | 2.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|