C22H27NO2 — CID 171314831
4-(dibenzylamino)-1-methylcyclohexane-1-carboxylic acid (PubChem CID 171314831) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 4-(dibenzylamino)-1-methylcyclohexane-1-carboxylic acid.
| Compound Name | 4-(dibenzylamino)-1-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171314831 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 4-(dibenzylamino)-1-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC(N(Cc2ccccc2)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27NO2/c1-22(21(24)25)14-12-20(13-15-22)23(16-18-8-4-2-5-9-18)17-19-10-6-3-7-11-19/h2-11,20H,12-17H2,1H3,(H,24,25) |
| InChIKey | SPZGNNHRPCWDJG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |