C25H35NO2 — CID 167064406
N,N-dibenzyl-4-(2-methoxypropoxy)-4-methylcyclohexan-1-amine (PubChem CID 167064406) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is N,N-dibenzyl-4-(2-methoxypropoxy)-4-methylcyclohexan-1-amine.
| Compound Name | N,N-dibenzyl-4-(2-methoxypropoxy)-4-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 167064406 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | N,N-dibenzyl-4-(2-methoxypropoxy)-4-methylcyclohexan-1-amine |
| SMILES | COC(C)COC1(C)CCC(N(Cc2ccccc2)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H35NO2/c1-21(27-3)20-28-25(2)16-14-24(15-17-25)26(18-22-10-6-4-7-11-22)19-23-12-8-5-9-13-23/h4-13,21,24H,14-20H2,1-3H3 |
| InChIKey | KIJGINPUJGAZPD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |