C26H36N2O2 — CID 175052692
4-amino-1-[4-(dibenzylamino)-1-hydroxycyclohexyl]cyclohexan-1-ol (PubChem CID 175052692) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 4-amino-1-[4-(dibenzylamino)-1-hydroxycyclohexyl]cyclohexan-1-ol.
| Compound Name | 4-amino-1-[4-(dibenzylamino)-1-hydroxycyclohexyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 175052692 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 4-amino-1-[4-(dibenzylamino)-1-hydroxycyclohexyl]cyclohexan-1-ol |
| SMILES | NC1CCC(O)(C2(O)CCC(N(Cc3ccccc3)Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C26H36N2O2/c27-23-11-15-25(29,16-12-23)26(30)17-13-24(14-18-26)28(19-21-7-3-1-4-8-21)20-22-9-5-2-6-10-22/h1-10,23-24,29-30H,11-20,27H2 |
| InChIKey | CGZMIJDNFFUCPT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |