C20H26N2 — CID 172601592
(1R,2S,3S)-1-N,1-N-dibenzyl-2-deuteriocyclohexane-1,3-diamine (PubChem CID 172601592) has the molecular formula C20H26N2 and a molecular weight of 295.45 g/mol. Its IUPAC name is (1R,2S,3S)-1-N,1-N-dibenzyl-2-deuteriocyclohexane-1,3-diamine.
| Compound Name | (1R,2S,3S)-1-N,1-N-dibenzyl-2-deuteriocyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 172601592 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.22 |
| IUPAC Name | (1R,2S,3S)-1-N,1-N-dibenzyl-2-deuteriocyclohexane-1,3-diamine |
| SMILES | [2H][C@@H]1[C@H](N(Cc2ccccc2)Cc2ccccc2)CCC[C@@H]1N |
| InChI | InChI=1S/C20H26N2/c21-19-12-7-13-20(14-19)22(15-17-8-3-1-4-9-17)16-18-10-5-2-6-11-18/h1-6,8-11,19-20H,7,12-16,21H2/t19-,20+/m0/s1/i14D/t14-,19-,20+ |
| InChIKey | DVSVBDZRSQEKSY-VHXDKZAJSA-N |
| XLogP | 3.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |