C20H28NOS2+ — CID 11156054
(1R,5S)-3-(2-methoxy-2,2-dithiophen-2-ylethyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane (PubChem CID 11156054) has the molecular formula C20H28NOS2+ and a molecular weight of 362.58 g/mol. Its IUPAC name is (1R,5S)-3-(2-methoxy-2,2-dithiophen-2-ylethyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-3-(2-methoxy-2,2-dithiophen-2-ylethyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 11156054 |
| Molecular Formula | C20H28NOS2+ |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (1R,5S)-3-(2-methoxy-2,2-dithiophen-2-ylethyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
| SMILES | COC(CC1C[C@H]2CC[C@@H](C1)[N+]2(C)C)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C20H28NOS2/c1-21(2)16-8-9-17(21)13-15(12-16)14-20(22-3,18-6-4-10-23-18)19-7-5-11-24-19/h4-7,10-11,15-17H,8-9,12-14H2,1-3H3/q+1/t15?,16-,17+ |
| InChIKey | HJHOSPLYEQTPKE-ALOPSCKCSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|