C19H24NS2+ — CID 11488957
3-(2,2-dithiophen-2-ylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane (PubChem CID 11488957) has the molecular formula C19H24NS2+ and a molecular weight of 330.54 g/mol. Its IUPAC name is 3-(2,2-dithiophen-2-ylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane.
| Compound Name | 3-(2,2-dithiophen-2-ylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 11488957 |
| Molecular Formula | C19H24NS2+ |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-(2,2-dithiophen-2-ylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
| SMILES | C[N+]1(C)C2CCC1CC(C=C(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C19H24NS2/c1-20(2)15-7-8-16(20)12-14(11-15)13-17(18-5-3-9-21-18)19-6-4-10-22-19/h3-6,9-10,13-16H,7-8,11-12H2,1-2H3/q+1 |
| InChIKey | DDAFFKQDEBQDHP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|