C19H24NS2+ — CID 6321280
(5R,9aS)-7-(dithiophen-2-ylmethylidene)-5-methyl-1,2,3,4,6,8,9,9a-octahydroquinolizin-5-ium (PubChem CID 6321280) has the molecular formula C19H24NS2+ and a molecular weight of 330.54 g/mol. Its IUPAC name is (5R,9aS)-7-(dithiophen-2-ylmethylidene)-5-methyl-1,2,3,4,6,8,9,9a-octahydroquinolizin-5-ium.
| Compound Name | (5R,9aS)-7-(dithiophen-2-ylmethylidene)-5-methyl-1,2,3,4,6,8,9,9a-octahydroquinolizin-5-ium |
|---|---|
| PubChem CID | 6321280 |
| Molecular Formula | C19H24NS2+ |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (5R,9aS)-7-(dithiophen-2-ylmethylidene)-5-methyl-1,2,3,4,6,8,9,9a-octahydroquinolizin-5-ium |
| SMILES | C[N@+]12CCCC[C@H]1CCC(=C(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C19H24NS2/c1-20-11-3-2-6-16(20)10-9-15(14-20)19(17-7-4-12-21-17)18-8-5-13-22-18/h4-5,7-8,12-13,16H,2-3,6,9-11,14H2,1H3/q+1/t16-,20+/m0/s1 |
| InChIKey | ZGSDGGRVFIYKKE-OXJNMPFZSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|