C24H16S5 — CID 102204980
2,5-bis(2,2-dithiophen-2-ylethenyl)thiophene (PubChem CID 102204980) has the molecular formula C24H16S5 and a molecular weight of 464.73 g/mol. Its IUPAC name is 2,5-bis(2,2-dithiophen-2-ylethenyl)thiophene.
| Compound Name | 2,5-bis(2,2-dithiophen-2-ylethenyl)thiophene |
|---|---|
| PubChem CID | 102204980 |
| Molecular Formula | C24H16S5 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 463.99 |
| IUPAC Name | 2,5-bis(2,2-dithiophen-2-ylethenyl)thiophene |
| SMILES | C(=C(c1cccs1)c1cccs1)c1ccc(C=C(c2cccs2)c2cccs2)s1 |
| InChI | InChI=1S/C24H16S5/c1-5-21(25-11-1)19(22-6-2-12-26-22)15-17-9-10-18(29-17)16-20(23-7-3-13-27-23)24-8-4-14-28-24/h1-16H |
| InChIKey | BYOWBPXZKQNVAY-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |