C28H22S4 — CID 10885407
2-[(1E,3E)-4-thiophen-2-ylbuta-1,3-dienyl]-5-[(1E,3E)-4-[5-[(1E,3E)-4-thiophen-2-ylbuta-1,3-dienyl]thiophen-2-yl]buta-1,3-dienyl]thiophene (PubChem CID 10885407) has the molecular formula C28H22S4 and a molecular weight of 486.75 g/mol. Its IUPAC name is 2-[(1E,3E)-4-thiophen-2-ylbuta-1,3-dienyl]-5-[(1E,3E)-4-[5-[(1E,3E)-4-thiophen-2-ylbuta-1,3-dienyl]thiophen-2-yl]buta-1,3-dienyl]thiophene.
| Compound Name | 2-[(1E,3E)-4-thiophen-2-ylbuta-1,3-dienyl]-5-[(1E,3E)-4-[5-[(1E,3E)-4-thiophen-2-ylbuta-1,3-dienyl]thiophen-2-yl]buta-1,3-dienyl]thiophene |
|---|---|
| PubChem CID | 10885407 |
| Molecular Formula | C28H22S4 |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 2-[(1E,3E)-4-thiophen-2-ylbuta-1,3-dienyl]-5-[(1E,3E)-4-[5-[(1E,3E)-4-thiophen-2-ylbuta-1,3-dienyl]thiophen-2-yl]buta-1,3-dienyl]thiophene |
| SMILES | C(/C=C/c1ccc(/C=C/C=C/c2ccc(/C=C/C=C/c3cccs3)s2)s1)=C\c1cccs1 |
| InChI | InChI=1S/C28H22S4/c1(9-23-15-7-21-29-23)3-11-25-17-19-27(31-25)13-5-6-14-28-20-18-26(32-28)12-4-2-10-24-16-8-22-30-24/h1-22H/b9-1+,10-2+,11-3+,12-4+,13-5+,14-6+ |
| InChIKey | WOKGGYBNVNHWOO-XLAKNADDSA-N |
| XLogP | 10.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|