C9H6S4 — CID 12601876
4-[(E)-2-thiophen-2-ylethenyl]-1,3-dithiole-2-thione (PubChem CID 12601876) has the molecular formula C9H6S4 and a molecular weight of 242.42 g/mol. Its IUPAC name is 4-[(E)-2-thiophen-2-ylethenyl]-1,3-dithiole-2-thione.
| Compound Name | 4-[(E)-2-thiophen-2-ylethenyl]-1,3-dithiole-2-thione |
|---|---|
| PubChem CID | 12601876 |
| Molecular Formula | C9H6S4 |
| Molecular Weight | 242.42 g/mol |
| Exact Mass | 241.94 |
| IUPAC Name | 4-[(E)-2-thiophen-2-ylethenyl]-1,3-dithiole-2-thione |
| SMILES | S=c1scc(/C=C/c2cccs2)s1 |
| InChI | InChI=1S/C9H6S4/c10-9-12-6-8(13-9)4-3-7-2-1-5-11-7/h1-6H/b4-3+ |
| InChIKey | IPLQUNYMMHJVGL-ONEGZZNKSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|