About 2-buta-1,3-dien-2-ylthiophene
2-buta-1,3-dien-2-ylthiophene (PubChem CID 58963888) has the molecular formula C8H8S
and a molecular weight of 136.22 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-ylthiophene.
Molecular Properties
| Compound Name | 2-buta-1,3-dien-2-ylthiophene |
| PubChem CID | 58963888 |
| Molecular Formula | C8H8S |
| Molecular Weight | 136.22 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | 2-buta-1,3-dien-2-ylthiophene |
| SMILES | C=CC(=C)c1cccs1 |
| InChI | InChI=1S/C8H8S/c1-3-7(2)8-5-4-6-9-8/h3-6H,1-2H2 |
| InChIKey | REXVDXFIQKSARA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-buta-1,3-dien-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-buta-1,3-dien-2-ylthiophene?
The IUPAC name of 2-buta-1,3-dien-2-ylthiophene (CID 58963888) is 2-buta-1,3-dien-2-ylthiophene.
What is the SMILES notation for 2-buta-1,3-dien-2-ylthiophene?
The canonical SMILES for 2-buta-1,3-dien-2-ylthiophene is C=CC(=C)c1cccs1.
What is the InChIKey of 2-buta-1,3-dien-2-ylthiophene?
The InChIKey is REXVDXFIQKSARA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8S/c1-3-7(2)8-5-4-6-9-8/h3-6H,1-2H2.
What are the key properties of 2-buta-1,3-dien-2-ylthiophene?
2-buta-1,3-dien-2-ylthiophene has a molecular weight of 136.22 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-buta-1,3-dien-2-ylthiophene is sourced from PubChem (CID 58963888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).