C11H11FS — CID 143881046
2-[(3E)-4-fluoro-5-methylhexa-1,3,5-trien-2-yl]thiophene (PubChem CID 143881046) has the molecular formula C11H11FS and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-[(3E)-4-fluoro-5-methylhexa-1,3,5-trien-2-yl]thiophene.
| Compound Name | 2-[(3E)-4-fluoro-5-methylhexa-1,3,5-trien-2-yl]thiophene |
|---|---|
| PubChem CID | 143881046 |
| Molecular Formula | C11H11FS |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-[(3E)-4-fluoro-5-methylhexa-1,3,5-trien-2-yl]thiophene |
| SMILES | C=C(C)/C(F)=C\C(=C)c1cccs1 |
| InChI | InChI=1S/C11H11FS/c1-8(2)10(12)7-9(3)11-5-4-6-13-11/h4-7H,1,3H2,2H3/b10-7+ |
| InChIKey | QIHIDXBRTVFSLQ-JXMROGBWSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|