C18H18N2NiO2S2 — CID 139178965
nickel(2+);(Z)-3-[2-[[(Z)-4-oxido-4-thiophen-2-ylbut-3-en-2-ylidene]amino]ethylimino]-1-thiophen-2-ylbut-1-en-1-olate (PubChem CID 139178965) has the molecular formula C18H18N2NiO2S2 and a molecular weight of 417.18 g/mol. Its IUPAC name is nickel(2+);(Z)-3-[2-[[(Z)-4-oxido-4-thiophen-2-ylbut-3-en-2-ylidene]amino]ethylimino]-1-thiophen-2-ylbut-1-en-1-olate.
| Compound Name | nickel(2+);(Z)-3-[2-[[(Z)-4-oxido-4-thiophen-2-ylbut-3-en-2-ylidene]amino]ethylimino]-1-thiophen-2-ylbut-1-en-1-olate |
|---|---|
| PubChem CID | 139178965 |
| Molecular Formula | C18H18N2NiO2S2 |
| Molecular Weight | 417.18 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | nickel(2+);(Z)-3-[2-[[(Z)-4-oxido-4-thiophen-2-ylbut-3-en-2-ylidene]amino]ethylimino]-1-thiophen-2-ylbut-1-en-1-olate |
| SMILES | CC(/C=C(\[O-])c1cccs1)=N\CC/N=C(C)/C=C(\[O-])c1cccs1.[Ni+2] |
| InChI | InChI=1S/C18H20N2O2S2.Ni/c1-13(11-15(21)17-5-3-9-23-17)19-7-8-20-14(2)12-16(22)18-6-4-10-24-18;/h3-6,9-12,21-22H,7-8H2,1-2H3;/q;+2/p-2/b15-11-,16-12-,19-13+,20-14+; |
| InChIKey | IGFIJTVDYCTYSV-FQHGFVCMSA-L |
| XLogP | 2.83 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.18 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|