C8H4F3NaO2S — CID 167420353
sodium (Z)-4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbut-1-en-1-olate (PubChem CID 167420353) has the molecular formula C8H4F3NaO2S and a molecular weight of 244.17 g/mol. Its IUPAC name is sodium (Z)-4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbut-1-en-1-olate.
| Compound Name | sodium (Z)-4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbut-1-en-1-olate |
|---|---|
| PubChem CID | 167420353 |
| Molecular Formula | C8H4F3NaO2S |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | sodium (Z)-4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbut-1-en-1-olate |
| SMILES | O=C(/C=C(\[O-])c1cccs1)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C8H5F3O2S.Na/c9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h1-4,12H;/q;+1/p-1/b5-4-; |
| InChIKey | JJYAYKJXFYAJOR-MKWAYWHRSA-M |
| XLogP | -1.42 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|