C14H9F3OS — CID 7124332
(Z)-4,4,4-trifluoro-3-phenyl-1-thiophen-2-ylbut-2-en-1-one (PubChem CID 7124332) has the molecular formula C14H9F3OS and a molecular weight of 282.29 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-3-phenyl-1-thiophen-2-ylbut-2-en-1-one.
| Compound Name | (Z)-4,4,4-trifluoro-3-phenyl-1-thiophen-2-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 7124332 |
| Molecular Formula | C14H9F3OS |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (Z)-4,4,4-trifluoro-3-phenyl-1-thiophen-2-ylbut-2-en-1-one |
| SMILES | O=C(/C=C(/c1ccccc1)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C14H9F3OS/c15-14(16,17)11(10-5-2-1-3-6-10)9-12(18)13-7-4-8-19-13/h1-9H/b11-9- |
| InChIKey | ILHYPSMBPFLOCP-LUAWRHEFSA-N |
| XLogP | 4.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|