C8H5F3O2S — CID 57367558
4,4,4-trifluoro-3-thiophen-2-ylbut-2-enoic acid (PubChem CID 57367558) has the molecular formula C8H5F3O2S and a molecular weight of 222.19 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-thiophen-2-ylbut-2-enoic acid.
| Compound Name | 4,4,4-trifluoro-3-thiophen-2-ylbut-2-enoic acid |
|---|---|
| PubChem CID | 57367558 |
| Molecular Formula | C8H5F3O2S |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 4,4,4-trifluoro-3-thiophen-2-ylbut-2-enoic acid |
| SMILES | O=C(O)C=C(c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C8H5F3O2S/c9-8(10,11)5(4-7(12)13)6-2-1-3-14-6/h1-4H,(H,12,13) |
| InChIKey | WQVDWYJYKVJHLQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|