C8H4F3NS — CID 11820181
(Z)-4,4,4-trifluoro-3-thiophen-2-ylbut-2-enenitrile (PubChem CID 11820181) has the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-3-thiophen-2-ylbut-2-enenitrile.
| Compound Name | (Z)-4,4,4-trifluoro-3-thiophen-2-ylbut-2-enenitrile |
|---|---|
| PubChem CID | 11820181 |
| Molecular Formula | C8H4F3NS |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.00 |
| IUPAC Name | (Z)-4,4,4-trifluoro-3-thiophen-2-ylbut-2-enenitrile |
| SMILES | N#C/C=C(\c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C8H4F3NS/c9-8(10,11)6(3-4-12)7-2-1-5-13-7/h1-3,5H/b6-3+ |
| InChIKey | DMKYIPNYSKEEIK-ZZXKWVIFSA-N |
| XLogP | 3.22 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|