C14H10N2O2S — CID 2766405
4-[[(Z)-2-cyano-2-thiophen-2-ylethenyl]amino]benzoic acid (PubChem CID 2766405) has the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-2-thiophen-2-ylethenyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-2-cyano-2-thiophen-2-ylethenyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2766405 |
| Molecular Formula | C14H10N2O2S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 4-[[(Z)-2-cyano-2-thiophen-2-ylethenyl]amino]benzoic acid |
| SMILES | N#C/C(=C/Nc1ccc(C(=O)O)cc1)c1cccs1 |
| InChI | InChI=1S/C14H10N2O2S/c15-8-11(13-2-1-7-19-13)9-16-12-5-3-10(4-6-12)14(17)18/h1-7,9,16H,(H,17,18)/b11-9- |
| InChIKey | ZCAUISOUJUFPIO-LUAWRHEFSA-N |
| XLogP | 3.42 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|