C19H17ClN8OS — CID 169343883
3-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343883) has the molecular formula C19H17ClN8OS and a molecular weight of 440.92 g/mol. Its IUPAC name is 3-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343883 |
| Molecular Formula | C19H17ClN8OS |
| Molecular Weight | 440.92 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 3-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(N2CCN(C(=O)c3cccs3)CC2)c(Cl)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C19H17ClN8OS/c20-15-10-14(22-12-13(11-21)18-23-25-26-24-18)3-4-16(15)27-5-7-28(8-6-27)19(29)17-2-1-9-30-17/h1-4,9-10,12,22H,5-8H2,(H,23,24,25,26) |
| InChIKey | LHMDMEXTLOEVID-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.92 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|