C25H26ClN3O5S — CID 4317842
N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 4317842) has the molecular formula C25H26ClN3O5S and a molecular weight of 516.02 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 4317842 |
| Molecular Formula | C25H26ClN3O5S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3CCN(C(=O)c4cccs4)CC3)c(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H26ClN3O5S/c1-32-20-13-16(14-21(33-2)23(20)34-3)24(30)27-17-6-7-19(18(26)15-17)28-8-10-29(11-9-28)25(31)22-5-4-12-35-22/h4-7,12-15H,8-11H2,1-3H3,(H,27,30) |
| InChIKey | GOAXUBQNLXULCW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|