C29H25ClN4O2S2 — CID 17317892
N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-phenylbenzamide (PubChem CID 17317892) has the molecular formula C29H25ClN4O2S2 and a molecular weight of 561.13 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-phenylbenzamide.
| Compound Name | N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 17317892 |
| Molecular Formula | C29H25ClN4O2S2 |
| Molecular Weight | 561.13 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | N-[[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-phenylbenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3cccs3)CC2)c(Cl)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25ClN4O2S2/c30-24-19-23(12-13-25(24)33-14-16-34(17-15-33)28(36)26-7-4-18-38-26)31-29(37)32-27(35)22-10-8-21(9-11-22)20-5-2-1-3-6-20/h1-13,18-19H,14-17H2,(H2,31,32,35,37) |
| InChIKey | RBSCQMYJMIHHIZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.13 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|