C31H24ClN3O4S — CID 17319362
N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-4-(2-oxochromen-3-yl)benzamide (PubChem CID 17319362) has the molecular formula C31H24ClN3O4S and a molecular weight of 570.07 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-4-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-4-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 17319362 |
| Molecular Formula | C31H24ClN3O4S |
| Molecular Weight | 570.07 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-4-(2-oxochromen-3-yl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3cccs3)CC2)c(Cl)c1)c1ccc(-c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C31H24ClN3O4S/c32-25-19-23(11-12-26(25)34-13-15-35(16-14-34)30(37)28-6-3-17-40-28)33-29(36)21-9-7-20(8-10-21)24-18-22-4-1-2-5-27(22)39-31(24)38/h1-12,17-19H,13-16H2,(H,33,36) |
| InChIKey | IUSASMHCDMOPHQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.07 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|