C23H22Cl2N4OS2 — CID 3322703
N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 3322703) has the molecular formula C23H22Cl2N4OS2 and a molecular weight of 505.50 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3322703 |
| Molecular Formula | C23H22Cl2N4OS2 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | N-[[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)c(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C23H22Cl2N4OS2/c24-18-5-2-1-4-16(18)15-28-9-11-29(12-10-28)20-8-7-17(14-19(20)25)26-23(31)27-22(30)21-6-3-13-32-21/h1-8,13-14H,9-12,15H2,(H2,26,27,30,31) |
| InChIKey | ROBARMBNFPBPIN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|