C18H14ClF3N8 — CID 169345395
3-[3-chloro-4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345395) has the molecular formula C18H14ClF3N8 and a molecular weight of 434.81 g/mol. Its IUPAC name is 3-[3-chloro-4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-chloro-4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345395 |
| Molecular Formula | C18H14ClF3N8 |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 3-[3-chloro-4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(-n2nc(C(F)(F)F)c3c2CCCC3)c(Cl)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C18H14ClF3N8/c19-13-7-11(24-9-10(8-23)17-25-28-29-26-17)5-6-15(13)30-14-4-2-1-3-12(14)16(27-30)18(20,21)22/h5-7,9,24H,1-4H2,(H,25,26,28,29) |
| InChIKey | CHCRUROJBNPUOW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|