C14H11ClF3N5 — CID 169325956
1-(4-azido-2-chlorophenyl)-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole (PubChem CID 169325956) has the molecular formula C14H11ClF3N5 and a molecular weight of 341.72 g/mol. Its IUPAC name is 1-(4-azido-2-chlorophenyl)-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole.
| Compound Name | 1-(4-azido-2-chlorophenyl)-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 169325956 |
| Molecular Formula | C14H11ClF3N5 |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 1-(4-azido-2-chlorophenyl)-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole |
| SMILES | [N-]=[N+]=Nc1ccc(-n2nc(C(F)(F)F)c3c2CCCC3)c(Cl)c1 |
| InChI | InChI=1S/C14H11ClF3N5/c15-10-7-8(20-22-19)5-6-12(10)23-11-4-2-1-3-9(11)13(21-23)14(16,17)18/h5-7H,1-4H2 |
| InChIKey | PGYLMQGYGNFDSG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|