C16H15Cl2F3N4 — CID 169368179
2-chloro-N'-[5-chloro-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]phenyl]ethanimidamide (PubChem CID 169368179) has the molecular formula C16H15Cl2F3N4 and a molecular weight of 391.22 g/mol. Its IUPAC name is 2-chloro-N'-[5-chloro-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[5-chloro-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169368179 |
| Molecular Formula | C16H15Cl2F3N4 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-chloro-N'-[5-chloro-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1cc(Cl)ccc1-n1nc(C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C16H15Cl2F3N4/c17-8-14(22)23-11-7-9(18)5-6-13(11)25-12-4-2-1-3-10(12)15(24-25)16(19,20)21/h5-7H,1-4,8H2,(H2,22,23) |
| InChIKey | DVSARYCFUNSEOV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|