C14H11F6N3 — CID 19627043
5-(trifluoromethyl)-2-[3-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]aniline (PubChem CID 19627043) has the molecular formula C14H11F6N3 and a molecular weight of 335.25 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2-[3-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]aniline.
| Compound Name | 5-(trifluoromethyl)-2-[3-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]aniline |
|---|---|
| PubChem CID | 19627043 |
| Molecular Formula | C14H11F6N3 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-(trifluoromethyl)-2-[3-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]aniline |
| SMILES | Nc1cc(C(F)(F)F)ccc1-n1nc(C(F)(F)F)c2c1CCC2 |
| InChI | InChI=1S/C14H11F6N3/c15-13(16,17)7-4-5-11(9(21)6-7)23-10-3-1-2-8(10)12(22-23)14(18,19)20/h4-6H,1-3,21H2 |
| InChIKey | OHSUQMDTBAMRRP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|