C23H21F6N3O5 — CID 168633997
dimethyl 3-[5-(trifluoromethyl)-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168633997) has the molecular formula C23H21F6N3O5 and a molecular weight of 533.43 g/mol. Its IUPAC name is dimethyl 3-[5-(trifluoromethyl)-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[5-(trifluoromethyl)-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168633997 |
| Molecular Formula | C23H21F6N3O5 |
| Molecular Weight | 533.43 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | dimethyl 3-[5-(trifluoromethyl)-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C(F)(F)F)ccc2-n2nc(C(F)(F)F)c3c2CCCC3)COC1 |
| InChI | InChI=1S/C23H21F6N3O5/c1-35-20(33)14-10-37-11-31(18(14)21(34)36-2)17-9-12(22(24,25)26)7-8-16(17)32-15-6-4-3-5-13(15)19(30-32)23(27,28)29/h7-9H,3-6,10-11H2,1-2H3 |
| InChIKey | BUCIMONSLZPICT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |