C19H24N2O5 — CID 168633036
dimethyl 3-(2-methyl-4-pyrrolidin-1-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168633036) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is dimethyl 3-(2-methyl-4-pyrrolidin-1-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(2-methyl-4-pyrrolidin-1-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168633036 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | dimethyl 3-(2-methyl-4-pyrrolidin-1-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(N3CCCC3)cc2C)COC1 |
| InChI | InChI=1S/C19H24N2O5/c1-13-10-14(20-8-4-5-9-20)6-7-16(13)21-12-26-11-15(18(22)24-2)17(21)19(23)25-3/h6-7,10H,4-5,8-9,11-12H2,1-3H3 |
| InChIKey | BHMSCKFGNCPYGR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|