C14H15NO8S — CID 168601317
4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]benzenesulfonic acid (PubChem CID 168601317) has the molecular formula C14H15NO8S and a molecular weight of 357.34 g/mol. Its IUPAC name is 4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]benzenesulfonic acid.
| Compound Name | 4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 168601317 |
| Molecular Formula | C14H15NO8S |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]benzenesulfonic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(S(=O)(=O)O)cc2)COC1 |
| InChI | InChI=1S/C14H15NO8S/c1-21-13(16)11-7-23-8-15(12(11)14(17)22-2)9-3-5-10(6-4-9)24(18,19)20/h3-6H,7-8H2,1-2H3,(H,18,19,20) |
| InChIKey | XVSVQTOCWAHCIC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|