C18H24N2O8S — CID 168634492
dimethyl 3-[4-(3-methoxypropylsulfamoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168634492) has the molecular formula C18H24N2O8S and a molecular weight of 428.46 g/mol. Its IUPAC name is dimethyl 3-[4-(3-methoxypropylsulfamoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[4-(3-methoxypropylsulfamoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168634492 |
| Molecular Formula | C18H24N2O8S |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | dimethyl 3-[4-(3-methoxypropylsulfamoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COCCCNS(=O)(=O)c1ccc(N2COCC(C(=O)OC)=C2C(=O)OC)cc1 |
| InChI | InChI=1S/C18H24N2O8S/c1-25-10-4-9-19-29(23,24)14-7-5-13(6-8-14)20-12-28-11-15(17(21)26-2)16(20)18(22)27-3/h5-8,19H,4,9-12H2,1-3H3 |
| InChIKey | YGQRIKKLSZMPSD-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|