C18H21BrN2O6 — CID 168632871
dimethyl 3-(3-bromo-4-morpholin-4-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168632871) has the molecular formula C18H21BrN2O6 and a molecular weight of 441.28 g/mol. Its IUPAC name is dimethyl 3-(3-bromo-4-morpholin-4-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(3-bromo-4-morpholin-4-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168632871 |
| Molecular Formula | C18H21BrN2O6 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | dimethyl 3-(3-bromo-4-morpholin-4-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(N3CCOCC3)c(Br)c2)COC1 |
| InChI | InChI=1S/C18H21BrN2O6/c1-24-17(22)13-10-27-11-21(16(13)18(23)25-2)12-3-4-15(14(19)9-12)20-5-7-26-8-6-20/h3-4,9H,5-8,10-11H2,1-2H3 |
| InChIKey | NDCQKKYROJOZRF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|