C20H27N3O6 — CID 168636155
dimethyl 3-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168636155) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is dimethyl 3-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168636155 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | dimethyl 3-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(N3CCN(C)CC3)c(OC)c2)COC1 |
| InChI | InChI=1S/C20H27N3O6/c1-21-7-9-22(10-8-21)16-6-5-14(11-17(16)26-2)23-13-29-12-15(19(24)27-3)18(23)20(25)28-4/h5-6,11H,7-10,12-13H2,1-4H3 |
| InChIKey | MVIAPTWARUUAKC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|