C23H30BrN3O7 — CID 168633740
dimethyl 3-[3-bromo-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168633740) has the molecular formula C23H30BrN3O7 and a molecular weight of 540.41 g/mol. Its IUPAC name is dimethyl 3-[3-bromo-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3-bromo-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168633740 |
| Molecular Formula | C23H30BrN3O7 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | dimethyl 3-[3-bromo-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)c(Br)c2)COC1 |
| InChI | InChI=1S/C23H30BrN3O7/c1-23(2,3)34-22(30)26-10-8-25(9-11-26)18-7-6-15(12-17(18)24)27-14-33-13-16(20(28)31-4)19(27)21(29)32-5/h6-7,12H,8-11,13-14H2,1-5H3 |
| InChIKey | BEDOUFMIEVTGDZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 97.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|