C25H30N6O7 — CID 168634179
dimethyl 3-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168634179) has the molecular formula C25H30N6O7 and a molecular weight of 526.55 g/mol. Its IUPAC name is dimethyl 3-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168634179 |
| Molecular Formula | C25H30N6O7 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | dimethyl 3-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(-c3nc(N4CCOCC4)nc(N4CCOCC4)n3)cc2)COC1 |
| InChI | InChI=1S/C25H30N6O7/c1-34-22(32)19-15-38-16-31(20(19)23(33)35-2)18-5-3-17(4-6-18)21-26-24(29-7-11-36-12-8-29)28-25(27-21)30-9-13-37-14-10-30/h3-6H,7-16H2,1-2H3 |
| InChIKey | YLJSHMASCKYWHN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 128.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |